CAS 40187-51-7
:5-Acetyl-2-hydroxybenzamide
Description:
5-Acetyl-2-hydroxybenzamide, with the CAS number 40187-51-7, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both an acetyl group and a hydroxyl group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The acetyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including acylation and condensation. The hydroxyl group enhances its potential for forming hydrogen bonds, influencing its physical properties, such as melting and boiling points. Additionally, 5-acetyl-2-hydroxybenzamide may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in organic synthesis and as an intermediate in the production of more complex molecules. Overall, this compound's unique combination of functional groups provides a versatile platform for further chemical exploration and application.
Formula:C9H9NO3
InChI:InChI=1S/C9H9NO3/c1-5(11)6-2-3-8(12)7(4-6)9(10)13/h2-4,12H,1H3,(H2,10,13)
InChI key:InChIKey=LWAQTCWTCCNHJR-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(C(C)=O)=CC=C1O
Synonyms:- 5-Acetosalicylamide
- 5-Acetyl-2-hydroxybenzamide
- 5-Acetylsalicylamide/5-Acetosalicylamide
- Benzamide, 5-acetyl-2-hydroxy-
- 5-Acetylsalicylamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
5-Acetyl-2-hydroxybenzamide
CAS:Formula:C9H9NO3Purity:98%Color and Shape:SolidMolecular weight:179.17275-Acetylsalicylamide
CAS:Formula:C9H9NO3Purity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:179.185-Acetylsalicylamide
CAS:Controlled ProductApplications 5-Acetylsalicylamide is used as a reagent in the synthesis of Phosphotyrosine(P365000) peptidomimetic prodrugs, compounds that have similar structure to small protein-like chains in order to mimic peptide activities. 5-Acetylsalicylamide is also used as a reagent to prepare 4-aminopiperidine ureas, compounds that act as human β3 adrenergic receptor agonists.
References Ashwell, M., et al.: Bioorgan. Med. Chem. Lett., 11, 3123 (2001); Garrido-Hernandez, H., et al.: J. Med. Chem., 49, 3368 (2006)Formula:C9H9NO3Color and Shape:NeatMolecular weight:179.175-Acetyl-2-hydroxybenzamide
CAS:Formula:C9H9NO3Purity:98%Color and Shape:No data available.Molecular weight:179.1755-Acetylsalicylamide
CAS:5-Acetylsalicylamide is a synthetic compound with anti-tumor properties. It is an acetylation agent that is used in the synthesis of other drugs, such as aspirin and acetaminophen. This reaction can be carried out at room temperature in aqueous acidic media with ammonium chloride or acetic acid. Acylation reactions are very efficient and can be carried out at low temperatures if ferrocene is used as catalyst. The nucleophilic character of 5-acetylsalicylamide makes it a good nucleophile for substitution reactions, which is the reason why it reacts efficiently in acylation reactions.Purity:Min. 95%







