CAS 401916-49-2

(3S)-4-(4-tert-butylphenyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid

Description:

The chemical substance known as (3S)-4-(4-tert-butylphenyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}butanoic acid, with the CAS number 401916-49-2, is a synthetic compound primarily used in the field of medicinal chemistry and peptide synthesis. This compound features a chiral center, indicated by the (3S) configuration, which contributes to its potential biological activity and specificity. The presence of the tert-butylphenyl group enhances its lipophilicity, potentially improving its membrane permeability. The fluorenylmethoxycarbonyl (Fmoc) group serves as a protective moiety for the amino group, facilitating its use in solid-phase peptide synthesis. The carboxylic acid functional group at the end of the butanoic acid chain is crucial for its reactivity and solubility in polar solvents. Overall, this compound's unique structure, characterized by its bulky substituents and functional groups, makes it a valuable intermediate in the development of peptide-based therapeutics and other bioactive molecules.

Formula: C₂₉H₃₁NO₄

InChI: InChI=1/C29H31NO4/c1-29(2,3)20-14-12-19(13-15-20)16-21(17-27(31)32)30-28(33)34-18-26-24-10-6-4-8-22(24)23-9-5-7-11-25(23)26/h4-15,21,26H,16-18H2,1-3H3,(H,30,33)(H,31,32)/t21-/m0/s1

SMILES: CC(C)(C)c1ccc(cc1)C[C@@H](CC(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12

Synonyms:

• Fmoc-(R)-3-Amino-4-(4-Tert-Butyl-Phenyl)-Butyric Acid

Fmoc-(R)-3-amino-4-(4-t-butyl-phenyl)-butyric acid

CAS: 401916-49-2

Formula: C₂₉H₃₁NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 457.5607

Ref: IN-DA00741E

Fmoc-(R)-3-amino-4-(4-t-butyl-phenyl)-butyric acid

CAS: 401916-49-2

Fmoc-(R)-3-amino-4-(4-t-butyl-phenyl)-butyric acid

Formula: C₂₉H₃₁NO₄

Purity: 95%

Color and Shape: white solid

Molecular weight: 457.56g/mol

Ref: 54-OR930345

Fmoc-(R)-3-amino-4-(4-tert-butyl-phenyl)-butyric acid

CAS: 401916-49-2

Fmoc-3-Amino-4-(4-tertbutylphenyl)butyric acid is a versatile building block that can be used in the synthesis of complex compounds. Fmoc-3-Amino-4-(4-tertbutylphenyl)butyric acid is an intermediate for the production of speciality chemicals and reagents. It is also a useful scaffold in chemical reactions, as well as a reaction component. Fmoc-(R)-3-Amino-4-(4-tertbutylphenyl)butyric acid is soluble in ethanol and ether, but insoluble in water.

Formula: C₂₉H₃₁NO₄

Purity: Min. 95%

Color and Shape: White To Off-White Solid

Molecular weight: 457.56 g/mol

Ref: 3D-FF50256

Fmoc-R-3-amino-4-(4-tert-butylphenyl)-butyric acid

CAS: 401916-49-2

Purity: 97%

Molecular weight: 457.5700073

Ref: 10-F624372