CymitQuimica logo

CAS 401916-61-8

:

Poly(oxy-1,2-ethanediyl), α-[2-[(3-mercapto-1-oxopropyl)amino]ethyl]-ω-methoxy-

Description:
Poly(oxy-1,2-ethanediyl), α-[2-[(3-mercapto-1-oxopropyl)amino]ethyl]-ω-methoxy- is a synthetic polymer characterized by its polyether backbone, which is derived from ethylene oxide. This compound features a methoxy group at one end and a functional group containing a mercapto group and an amino group at the other end, which can facilitate various chemical reactions and interactions. The presence of the mercapto group suggests potential for thiol-related chemistry, including cross-linking and conjugation with other molecules, making it useful in applications such as drug delivery, bioconjugation, and materials science. The polymer's hydrophilic nature, due to the polyether structure, enhances its solubility in aqueous environments, which is advantageous for biological applications. Additionally, the amino group can participate in further chemical modifications, allowing for the tailoring of the polymer's properties for specific uses. Overall, this compound exemplifies the versatility of polyether-based polymers in various fields, including biomedical engineering and materials development.
Formula:(C2H4O)nC6H13NO2S
Synonyms:
  • Poly(oxy-1,2-ethanediyl), α-[2-[(3-mercapto-1-oxopropyl)amino]ethyl]-ω-methoxy-
  • O-[2-(3-Mercaptopropionylamino)ethyl]-O-methylpolyethylene glycol
  • O-[2-(3-Mercaptopropionylamino)ethyl]-O′-methylpolyethylene glycol
  • O-[2-(3-Mercaptopropionylamino)ethyl]-O′-methylpoly(ethylene glycol)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.