CAS 401941-54-6
:(2S)-2,3-dihydro-1,4-benzodioxin-2-yl(piperazin-1-yl)methanone
Description:
(2S)-2,3-dihydro-1,4-benzodioxin-2-yl(piperazin-1-yl)methanone, with the CAS number 401941-54-6, is a chemical compound characterized by its unique structural features, which include a benzodioxin moiety and a piperazine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the piperazine group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The stereochemistry indicated by the (2S) designation implies specific spatial arrangements that can influence the compound's reactivity and interaction with biological systems. Additionally, the methanone functional group may impart certain reactivity patterns, such as the ability to participate in nucleophilic attacks or form hydrogen bonds. Overall, this compound's characteristics, including its molecular structure and functional groups, suggest potential applications in pharmacology and drug development, although specific biological activities would require further investigation through experimental studies.
Formula:C13H16N2O3
InChI:InChI=1/C13H16N2O3/c16-13(15-7-5-14-6-8-15)12-9-17-10-3-1-2-4-11(10)18-12/h1-4,12,14H,5-9H2/t12-/m0/s1
SMILES:c1ccc2c(c1)OC[C@@H](C(=O)N1CCNCC1)O2
Synonyms:- Methanone, [(2S)-2,3-dihydro-1,4-benzodioxin-2-yl]-1-piperazinyl-
- (2S)-2,3-Dihydro-1,4-benzodioxin-2-yl(piperazin-1-yl)methanone
- (S)-(2,3-dihydrobenzo[b][1,4]dioxin-2-yl)(piperazin-1-yl)methanone
- (S)-1,4-BENZODIOXAN-2-CARBOXYPIPERAZINE
- (S)-(2,3-DIHYDRO-BENZO[1,4]DIOXIN-2-YL)-PIPERAZIN-1-YL-METHANONE
- REF DUPL: (S)-1,4-Benzodioxan-2-carboxypiperazine
- (S)-N-(1,4-benzodioxan-2-carbonyl)piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-1,4-Benzodioxan-2-carboxypiperazine
CAS:Formula:C13H16N2O3Color and Shape:SolidMolecular weight:248.2777(S)-1,4-Benzodioxan-2-carboxypiperazine
CAS:Formula:C13H16N2O3Purity:98.0%Color and Shape:Solid, No data available.Molecular weight:248.282(S)-1,4-Benzodioxan-2-carboxypiperazine
CAS:Controlled ProductApplications (S)-1,4-Benzodioxan-2-carboxypiperazine is the key chiral intermediate for the synthesis of (S)-doxazosin (D537500, Mesylate salt), a selective α1-adrenoceptor antagonist. Doxazosin relaxes smooth muscles of the prostate.
References Fang, Q., et al.: Tetrahedron Asym., 12, 2169 (2001); Elliott, H.L., et al.: Brit. J. Clin. Pharmacol., 13, 699 (1982); de Leeuw, P.W., et al.: Eur. J. Clin. Pharmacol., 23, 397 (1982)Formula:C13H16N2O3Color and Shape:NeatMolecular weight:248.28


