CAS 40197-02-2
:3-iodo-2,5-dimethylthiophene
Description:
3-Iodo-2,5-dimethylthiophene is a heterocyclic organic compound characterized by its thiophene ring, which is a five-membered aromatic ring containing sulfur. The presence of iodine at the 3-position and two methyl groups at the 2 and 5 positions contributes to its unique chemical properties. This compound typically exhibits a yellow to brown color and is soluble in organic solvents. Its structure allows for potential reactivity in electrophilic substitution reactions due to the electron-donating effects of the methyl groups, as well as the presence of the iodine atom, which can participate in various chemical transformations. The compound may also display interesting electronic properties due to the conjugated system of the thiophene ring. In terms of applications, derivatives of thiophene are often explored in organic electronics, pharmaceuticals, and as intermediates in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-iodo-2,5-dimethylthiophene is a valuable compound in the field of organic chemistry.
Formula:C6H7IS
InChI:InChI=1/C6H7IS/c1-4-3-6(7)5(2)8-4/h3H,1-2H3
SMILES:Cc1cc(c(C)s1)I
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-iodo-2,5-diMethylthiophene
CAS:Formula:C6H7ISPurity:98%Color and Shape:LiquidMolecular weight:238.08923-Iodo-2,5-dimethylthiophene
CAS:3-Iodo-2,5-dimethylthiophene is an alkenylation agent. It can be synthesized by reacting 3-iodo-2,4,6-trimethylphenol with boronic acid in the presence of ethylene at high temperatures. The reaction is irreversible and can be used to form substituted derivatives that are irreversibly alkenylated. 3-Iodo-2,5-dimethylthiophene has a number of optical properties including photochromism and diffraction. It has been shown to be useful for the synthesis of novel materials with optical properties such as photochromism and diffraction.
Formula:C6H7ISPurity:Min. 95%Molecular weight:238.09 g/mol



