CAS 402-19-7

2-Methanesulfonyl-5-(trifluoromethyl)aniline

Description:

2-Methanesulfonyl-5-(trifluoromethyl)aniline, with the CAS number 402-19-7, is an organic compound characterized by the presence of both a methanesulfonyl group and a trifluoromethyl group attached to an aniline structure. This compound typically appears as a solid or crystalline substance and is known for its polar nature due to the sulfonyl group, which enhances its solubility in polar solvents. The trifluoromethyl group contributes to its unique electronic properties, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the presence of the aniline moiety suggests potential reactivity in electrophilic aromatic substitution reactions. Safety data indicates that, like many sulfonamides and fluorinated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 2-Methanesulfonyl-5-(trifluoromethyl)aniline is a compound of interest in synthetic organic chemistry, particularly in the development of new chemical entities.

Formula: C₈H₈F₃NO₂S

InChI: InChI=1/C8H8F3NO2S/c1-15(13,14)7-3-2-5(4-6(7)12)8(9,10)11/h2-4H,12H2,1H3

SMILES: CS(=O)(=O)c1ccc(cc1N)C(F)(F)F

Synonyms:

• 2-(Methylsulfonyl)-5-(Trifluoromethyl)Aniline

Benzenamine,2-(methylsulfonyl)-5-(trifluoromethyl)-

CAS: 402-19-7

Formula: C₈H₈F₃NO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.2148

Ref: IN-DA00740Y

3-Amino-4-(methylsulphonyl)benzotrifluoride

CAS: 402-19-7

3-Amino-4-(methylsulphonyl)benzotrifluoride

Formula: C₈H₈F₃NO₂S

Purity: ≥95%

Color and Shape: off-white solid

Molecular weight: 239.21g/mol

Ref: 54-PC11196

2-(Methylsulfonyl)-5-(trifluoromethyl)aniline

CAS: 402-19-7

Formula: C₈H₈F₃NO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 239.21

Ref: 10-F023657