CymitQuimica logo

CAS 402-57-3

:

[4-(fluorosulfonyl)phenyl]acetic acid

Description:
[4-(Fluorosulfonyl)phenyl]acetic acid, with the CAS number 402-57-3, is an organic compound characterized by the presence of a phenyl ring substituted with a fluorosulfonyl group and an acetic acid moiety. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its polar nature due to the presence of the sulfonyl and carboxylic acid functional groups. The fluorosulfonyl group imparts unique reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound is likely to exhibit strong hydrogen bonding capabilities due to the carboxylic acid group, influencing its solubility in polar solvents. Additionally, the presence of fluorine enhances its electrophilic character, which can be exploited in various chemical reactions. Safety precautions should be taken when handling this substance, as it may pose health hazards, including irritation to the skin and respiratory system. Proper storage and disposal methods are essential to mitigate environmental impact.
Formula:C8H7FO4S
InChI:InChI=1/C8H7FO4S/c9-14(12,13)7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11)
InChI key:VARMWPGASRMINF-UHFFFAOYSA-N
SMILES:c1cc(ccc1CC(=O)O)S(=O)(=O)F
Found 4 products.