CAS 402-66-4: 5-Fluoronicotinic acid

Description:5-Fluoronicotinic acid is a heterocyclic organic compound that belongs to the class of fluorinated pyridine derivatives. It features a pyridine ring substituted with a carboxylic acid group and a fluorine atom at the 5-position. This compound is characterized by its molecular formula, which typically includes carbon, hydrogen, nitrogen, oxygen, and fluorine atoms. It is a white to off-white solid that is soluble in polar solvents such as water and alcohols, making it useful in various chemical applications. The presence of the fluorine atom can enhance the compound's biological activity and lipophilicity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Additionally, 5-fluoronicotinic acid can serve as a building block in organic synthesis, facilitating the introduction of functional groups in more complex molecules. Its unique properties and reactivity make it a valuable compound in both academic and industrial chemistry settings.

Formula:C₆H₄FNO₂

InChI:InChI=1S/C6H4FNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,(H,9,10)

InChI key:InChIKey=BXZSBDDOYIWMGC-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=NC=C(F)C1

Synonyms:
3-Pyridinecarboxylic acid, 5-fluoro-
5-Fluoro-3-pyridinecarboxylic acid
Benzene, 1-fluoro-3-nitro-
Nicotinic acid, 5-fluoro-
5-Fluoronicotinic acid

Found 6 products.

Product data	Purity	Price range	Estimated delivery
5-Fluoronicotinic acid REF: IN-DA00349WCAS: 402-66-4	98%	To inquire	Tue 12 Aug 25
5-Fluoronicotinic acid REF: 54-PC2505CAS: 402-66-4	97%	31.00 €~93.00 €	Wed 13 Aug 25
5-Fluoronicotinic Acid REF: 3B-F0738CAS: 402-66-4	>98.0%(GC)(T)	27.00 €~68.00 €	Mon 18 Aug 25
5-Fluoropyridine-3-carboxylic acid REF: 10-F035868CAS: 402-66-4	97.0%	To inquire	Fri 22 Aug 25
5-Fluoronicotinic acid, 98% REF: 02-H61162CAS: 402-66-4	98%	- - -	Discontinued product
5-Fluoronicotinic acid REF: 3D-FF50865CAS: 402-66-4	Min. 95%	- - -	Discontinued product