CAS 402-94-8

2,4,6-Tris(bromofluoromethyl)-1,3,5-triazine

Description:

2,4,6-Tris(bromofluoromethyl)-1,3,5-triazine, with the CAS number 402-94-8, is a halogenated organic compound characterized by its triazine ring structure, which consists of alternating carbon and nitrogen atoms. This compound features three bromofluoromethyl groups attached to the triazine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits high thermal stability due to the presence of the triazine framework. The bromofluoromethyl groups enhance its reactivity and potential applications in various fields, including flame retardants and agrochemicals. Additionally, the presence of halogens in its structure can impart significant biological activity, making it of interest in medicinal chemistry. However, the environmental impact and toxicity of halogenated compounds necessitate careful handling and assessment. Overall, 2,4,6-Tris(bromofluoromethyl)-1,3,5-triazine is notable for its complex structure and potential utility in specialized applications, while also raising concerns regarding safety and environmental effects.

Formula: C₆H₃Br₃F₃N₃

InChI: InChI=1S/C6H3Br3F3N3/c7-1(10)4-13-5(2(8)11)15-6(14-4)3(9)12/h1-3H

InChI key: InChIKey=GRLJJIHVVOZKLC-UHFFFAOYSA-N

SMILES: C(Br)(F)C=1N=C(C(Br)F)N=C(C(Br)F)N1

Synonyms:

• s-Triazine, 2,4,6-tris(bromofluoromethyl)-
• 2,4,6-Tris(bromofluoromethyl)-1,3,5-triazine
• 1,3,5-Triazine, 2,4,6-tris(bromofluoromethyl)-

2,4,6-Tris[bromo(fluoro)methyl]-1,3,5-triazine

CAS: 402-94-8

2,4,6-Tris[bromo(fluoro)methyl]-1,3,5-triazine

Purity: 95%

Molecular weight: 413.82g/mol

Ref: 54-PC51110