CAS 40204-87-3
:phe-gly-gly-phe
Description:
The chemical substance known as "phe-gly-gly-phe," with the CAS number 40204-87-3, is a tetrapeptide composed of four amino acids: phenylalanine (Phe) and glycine (Gly). This peptide exhibits characteristics typical of peptides, including the ability to form hydrogen bonds and adopt specific conformations based on its amino acid sequence. The presence of phenylalanine contributes to its hydrophobic properties, while glycine, being the simplest amino acid, provides flexibility in the peptide chain. Such structural features can influence the peptide's biological activity, stability, and interactions with other biomolecules. Peptides like phe-gly-gly-phe are often studied for their potential roles in biological processes, including signaling pathways and as potential therapeutic agents. Additionally, their solubility and reactivity can vary depending on the surrounding environment, such as pH and ionic strength. Overall, the characteristics of this tetrapeptide make it a subject of interest in biochemistry and pharmacology.
Formula:C22H26N4O5
InChI:InChI=1/C22H26N4O5/c23-17(11-15-7-3-1-4-8-15)21(29)25-13-19(27)24-14-20(28)26-18(22(30)31)12-16-9-5-2-6-10-16/h1-10,17-18H,11-14,23H2,(H,24,27)(H,25,29)(H,26,28)(H,30,31)
SMILES:c1ccc(cc1)CC(C(=NCC(=NCC(=NC(Cc1ccccc1)C(=O)O)O)O)O)N
Synonyms:- H-Phe-Gly-Gly-Phe-OH
- Phenylalanylglycylglycylphenylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
H-Phe-Gly-Gly-Phe-OH
CAS:<p>H-Phe-Gly-Gly-Phe-OH is a tetrapeptide that is synthesized by the enzyme pepsin in a high concentration. Pepsin cleaves proline from the sequence (H-Phe-Gly) and replaces it with hydroxylated phenylalanine. The peptide is soluble in 0.1 M sodium acetate, pH 5.0, but precipitates at pH 4.0 or below. It binds to sephadex G100 but not to Sepharose CL4B or Sephadex G25M, and can be denatured by heating to 100°C for 10 minutes or by exposure to metal ions such as copper(II) sulfate. H-Phe-Gly-Gly-Phe-OH has been used as an analog for the amino acid sequence Gly-Leu in order to study its effects on receptor affinity and protein stability.br>br</p>Formula:C22H26N4O5Purity:Min. 95%Molecular weight:426.47 g/mol
