CAS 4021-12-9

3-methylpyridine-4-carboxylic acid

Description:

3-Methylpyridine-4-carboxylic acid, also known as 4-carboxy-3-methylpyridine, is an aromatic heterocyclic compound characterized by a pyridine ring substituted with a carboxylic acid group and a methyl group. Its molecular formula is C7H7NO2, indicating the presence of seven carbon atoms, seven hydrogen atoms, one nitrogen atom, and two oxygen atoms. This compound typically appears as a solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The compound exhibits acidic properties, as indicated by the carboxylic acid group, and can participate in various chemical reactions, including esterification and amidation. Its applications may include use in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, 3-methylpyridine-4-carboxylic acid can serve as a ligand in coordination chemistry due to the nitrogen atom in the pyridine ring, which can coordinate with metal ions.

Formula: C₇H₇NO₂

InChI: InChI=1/C7H7NO2/c1-5-4-8-3-2-6(5)7(9)10/h2-4H,1H3,(H,9,10)

SMILES: Cc1cnccc1C(=O)O

Synonyms:

• 3-Methylisonicotinic acid
• 4-Pyridinecarboxylic acid, 3-methyl-

3-Methyl-4-pyridinecarboxylic acid

CAS: 4021-12-9

Formula: C₇H₇NO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 137.1360

Ref: IN-DA003949

3-Methyl-4-pyridinecarboxylic acid

CAS: 4021-12-9

3-Methyl-4-pyridinecarboxylic acid

Purity: 97%

Molecular weight: 137.14g/mol

Ref: 54-OR912065

3-Methyl-isonicotinic acid

CAS: 4021-12-9

Formula: C₇H₇NO₂

Purity: 96%

Color and Shape: Brown powder

Molecular weight: 137.138

Ref: 10-F040096