CAS 40228-90-8
:7-Phenylheptanoic acid
Description:
7-Phenylheptanoic acid is an organic compound characterized by its long carbon chain and the presence of a phenyl group. It belongs to the class of carboxylic acids, which are known for their acidic properties due to the carboxyl functional group (-COOH). This compound features a seven-carbon aliphatic chain with a phenyl substituent at the seventh carbon position, contributing to its unique chemical behavior and potential applications. The presence of the phenyl group can enhance the compound's hydrophobic characteristics, influencing its solubility in organic solvents. 7-Phenylheptanoic acid may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its molecular structure allows for various reactions typical of carboxylic acids, such as esterification and acid-base reactions. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, can be influenced by the steric and electronic effects of the phenyl group. Overall, 7-Phenylheptanoic acid is a versatile compound with potential applications in various fields, including organic synthesis and medicinal chemistry.
Formula:C13H18O2
InChI:InChI=1/C13H18O2/c14-13(15)11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H,14,15)
SMILES:C(CCCC(=O)O)CCc1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Phenylheptanoic acid, 97%
CAS:7-Phenylheptanoic acid is used in the process to make amino acid derivatives. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code orFormula:C13H18O2Purity:97%Color and Shape:White/translucent to yellow fused solid,, clear liquid as meltMolecular weight:206.29



