CymitQuimica logo

CAS 40231-03-6

:

2-[(Trimethylsilyl)ethynyl]thiophene

Description:
2-[(Trimethylsilyl)ethynyl]thiophene is an organosilicon compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The compound features a trimethylsilyl group attached to an ethynyl group, which is further connected to the thiophene. This structure imparts unique electronic and optical properties, making it of interest in organic electronics and materials science. The trimethylsilyl group enhances the solubility of the compound in organic solvents and can influence its reactivity and stability. Additionally, the ethynyl group contributes to the compound's ability to participate in various coupling reactions, making it useful in synthetic organic chemistry. The presence of the thiophene moiety also allows for potential applications in organic semiconductors and photovoltaic devices due to its conjugated system. Overall, 2-[(Trimethylsilyl)ethynyl]thiophene is a versatile compound with significant implications in advanced material applications.
Formula:C9H12SSi
InChI:InChI=1/C9H12SSi/c1-11(2,3)8-6-9-5-4-7-10-9/h4-5,7H,1-3H3
InChI key:OQUBLKNISPLGJP-UHFFFAOYSA-N
SMILES:C[Si](C)(C)C#Cc1cccs1
Found 5 products.