CymitQuimica logo

CAS 40240-12-8

:

1-Benzyl-1,2,3,6-tetrahydropyridine

Description:
1-Benzyl-1,2,3,6-tetrahydropyridine is an organic compound characterized by its bicyclic structure, which includes a tetrahydropyridine ring fused with a benzyl group. This compound is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic benzyl group. The presence of the nitrogen atom in the tetrahydropyridine ring contributes to its basicity and potential reactivity, making it of interest in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, 1-benzyl-1,2,3,6-tetrahydropyridine may exhibit biological activity, which has led to research into its potential therapeutic uses. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C12H15N
InChI:InChI=1S/C12H15N/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-5,7-8H,6,9-11H2
InChI key:SIRJFTFGHZXRRZ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CN1CC=CCC1
Synonyms:
  • 1-(Phenylmethyl)-1,2,3,6-tetrahydropyridine
Found 4 products.