CAS 40243-87-6

Benzene, 1-ethenyl-3,5-dimethoxy-

Description:

Benzene, 1-ethenyl-3,5-dimethoxy- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an ethenyl group and two methoxy groups at the 3 and 5 positions. The presence of the ethenyl group introduces a vinyl functional group, which can participate in various chemical reactions, such as polymerization or addition reactions. The methoxy groups contribute to the compound's overall polarity and can influence its reactivity and solubility in different solvents. This compound is likely to exhibit properties typical of aromatic compounds, such as stability due to resonance, and may also show unique characteristics due to the presence of the substituents. Its applications could range from use in organic synthesis to potential roles in materials science, depending on its reactivity and functional properties. Safety and handling considerations should be taken into account, as with many organic compounds, particularly those with potential toxicity or environmental impact.

Formula: C₁₀H₁₂O₂

InChI: InChI=1S/C10H12O2/c1-4-8-5-9(11-2)7-10(6-8)12-3/h4-7H,1H2,2-3H3

InChI key: YYDWZJCCIAMZIH-UHFFFAOYSA-N

SMILES: COC1=CC(=CC(=C1)C=C)OC

1-Ethenyl-3,5-dimethoxybenzene

CAS: 40243-87-6

1-Ethenyl-3,5-dimethoxybenzene

Formula: C₁₀H₁₂O₂

Purity: ≥95%

Molecular weight: 164.2

Ref: 54-OR1144143

1-Ethenyl-3,5-dimethoxybenzene

CAS: 40243-87-6

1-Ethenyl-3,5-dimethoxybenzene is a monomer that can be used for anionic polymerization. This monomer is characterized by its high yield, which is consistent with the predictable conformation of the phenyl ring and the symmetric nature of the magnetic resonance spectra. The 1-ethenyl-3,5-dimethoxybenzene molecule has an anionic charge. It is also known to have a phenolic group, which provides ultraviolet absorption properties. The temperature range for this monomer's transition ranges from -20°C to 100°C.

Formula: C₁₀H₁₂O₂

Purity: Min. 95%

Molecular weight: 164.2 g/mol

Ref: 3D-QBA24387