CAS 40246-10-4: Glycitin
Description:Glycitin, with the CAS number 40246-10-4, is a naturally occurring isoflavone glycoside primarily found in soybeans and other legumes. It is a derivative of the isoflavone genistein, where a glucose molecule is attached, enhancing its solubility and bioavailability. Glycitin exhibits antioxidant properties, contributing to its potential health benefits, including anti-inflammatory effects and possible roles in hormone regulation. As a phytoestrogen, it can mimic estrogen in the body, which may have implications for menopausal symptoms and bone health. Glycitin is often studied for its potential therapeutic applications in various health conditions, including cancer and cardiovascular diseases. In terms of physical properties, glycitin is typically a white to off-white powder, soluble in water, and stable under normal storage conditions. Its safety profile is generally considered favorable, although further research is ongoing to fully understand its biological effects and mechanisms of action.
Formula:C22H22O10
InChI:InChI=1S/C22H22O10/c1-29-15-6-12-14(30-9-13(18(12)25)10-2-4-11(24)5-3-10)7-16(15)31-22-21(28)20(27)19(26)17(8-23)32-22/h2-7,9,17,19-24,26-28H,8H2,1H3/t17-,19-,20+,21-,22-/m1/s1
InChI key:InChIKey=OZBAVEKZGSOMOJ-MIUGBVLSSA-N
SMILES:O=C1C(=COC=2C=C(OC3OC(CO)C(O)C(O)C3O)C(OC)=CC12)C=4C=CC(O)=CC4
- Synonyms:
- 3-(4-Hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
- 3-(4-hydroxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
- 4H-1-Benzopyran-4-one, 7-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-3-(4-hydroxyphenyl)-6-methoxy-
- 7-(β-<span class="text-smallcaps">D</span>-Glucopyranosyloxy)-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
- Glycitein 7-O-glucoside
- Glycitein 7-O-β-glucoside
- Glycitein-7-β-O-glucoside
- 4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-3-(4-hydroxyphenyl)-6-methoxy-
- 7-(β-D-Glucopyranosyloxy)-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
