CAS 40248-34-8
:6-(trifluoroacetylamino)-1-hexanol
Description:
6-(Trifluoroacetylamino)-1-hexanol is an organic compound characterized by the presence of a hexanol backbone with a trifluoroacetylamino group at the sixth carbon position. This compound features a hydroxyl (-OH) group, which contributes to its solubility in polar solvents and can participate in hydrogen bonding. The trifluoroacetylamino moiety introduces significant electronegativity due to the presence of three fluorine atoms, which can influence the compound's reactivity and polarity. The trifluoroacetyl group is known for its ability to enhance the lipophilicity of molecules, potentially affecting their biological activity and interaction with other substances. Additionally, the presence of both hydrophilic (the hydroxyl group) and hydrophobic (the trifluoroacetyl group) components suggests that this compound may exhibit amphiphilic properties, making it of interest in various applications, including pharmaceuticals and materials science. Its unique structure may also impart specific characteristics in terms of stability, reactivity, and potential uses in synthesis or as a reagent in chemical reactions.
Formula:C8H14F3NO2
InChI:InChI=1/C8H14F3NO2/c9-8(10,11)7(14)12-5-3-1-2-4-6-13/h13H,1-6H2,(H,12,14)
SMILES:C(CCCO)CCN=C(C(F)(F)F)O
Synonyms:- N-(6-Hydroxyhexyl)trifluoroacetamide
- 2,2,2-trifluoro-N-(6-hydroxyhexyl)acetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
6-(TRIFLUOROACETYLAMINO)-1-HEXANOL
CAS:Formula:C8H14F3NO2Purity:95%Color and Shape:SolidMolecular weight:213.19752,2,2-Trifluoro-N-(6-hydroxyhexyl)acetamide
CAS:2,2,2-Trifluoro-N-(6-hydroxyhexyl)acetamidePurity:95%Molecular weight:213.2g/molN-(6-Hydroxyhexyl)trifluoroacetamide
CAS:6-(Trifluoroacetylamino)-1-Hexanol is a magnetic compound that has been shown to bind to liposomes and hydrophobic membranes. It is also amphipathic, meaning it contains both hydrophilic and hydrophobic properties. This compound can be used for the diagnosis of certain diseases, such as cancer, by detecting gadolinium ions in the body. 6-(Trifluoroacetylamino)-1-Hexanol is also an imidazolide ligand that binds to ribonucleotides and nucleic acid matrix proteins. This allows it to be used as a contrast agent in magnetic resonance imaging (MRI).Formula:C8H14F3NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:213.2 g/molN-(6-Hydroxyhexyl)trifluoroacetamide
CAS:Please enquire for more information about N-(6-Hydroxyhexyl)trifluoroacetamide including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H14F3NO2Molecular weight:213.2 g/molN-(Trifluoroacetyl)hexanolamine
CAS:Controlled ProductApplications N-(Trifluoroacetyl)hexanolamine (cas# 40248-34-8) is a compound useful in organic synthesis.
Formula:C8H14F3NO2Color and Shape:NeatMolecular weight:213.20



