CAS 40254-90-8

2H-pyrazolo[3,4-b]quinoxalin-3-amine

Description:

2H-pyrazolo[3,4-b]quinoxalin-3-amine is a heterocyclic organic compound characterized by its unique pyrazoloquinoxaline structure. This compound features a fused ring system that includes both pyrazole and quinoxaline moieties, contributing to its potential biological activity. It typically appears as a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of an amino group at the 3-position enhances its reactivity and potential for forming hydrogen bonds, which can influence its interactions in biological systems. This compound has garnered interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of oncology and neuropharmacology. Its structural characteristics may allow for interactions with various biological targets, making it a subject of research for therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by substituents on the ring system, which can be modified to enhance its pharmacological properties.

Formula: C₉H₇N₅

InChI: InChI=1/C9H7N5/c10-8-7-9(14-13-8)12-6-4-2-1-3-5(6)11-7/h1-4H,(H3,10,12,13,14)

SMILES: c1ccc2c(c1)nc1c(N)n[nH]c1n2

Synonyms:

• 1H-Pyrazolo[3,4-b]quinoxalin-3-amine
• 9H-Pyrazolo[3,4-b]quinoxalin-3-amine

Brimonidine Impurity 8

CAS: 40254-90-8

Formula: C₉H₇N₅

Color and Shape: Red Solid

Molecular weight: 185.19

Ref: 4Z-B-1624

NSC 693868

CAS: 40254-90-8

CDKs and GSK-3 inhibitor

Formula: C₉H₇N₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 185.19

Ref: TM-T23093