CAS 40256-99-3
:2-[4-(Acetylamino)phenoxy]-N-[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]acetamide
Description:
2-[4-(Acetylamino)phenoxy]-N-[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]acetamide, with CAS number 40256-99-3, is a synthetic organic compound characterized by its complex molecular structure, which includes an acetylamino group, a phenoxy moiety, and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the acetylamino group suggests potential interactions with biological targets, while the trifluoromethyl group may enhance lipophilicity and metabolic stability. Its molecular design indicates possible applications in medicinal chemistry, particularly in the development of therapeutic agents. The compound's stability, reactivity, and interaction with biological systems would depend on its specific functional groups and overall conformation. As with many synthetic compounds, safety and handling precautions are essential, and its effects on health and the environment should be thoroughly evaluated in any practical applications.
Formula:C20H21F3N2O3
InChI:InChI=1S/C20H21F3N2O3/c1-13(10-15-4-3-5-16(11-15)20(21,22)23)24-19(27)12-28-18-8-6-17(7-9-18)25-14(2)26/h3-9,11,13H,10,12H2,1-2H3,(H,24,27)(H,25,26)
InChI key:InChIKey=SKWBJBJQEUEFCY-UHFFFAOYSA-N
SMILES:C(C(NC(COC1=CC=C(NC(C)=O)C=C1)=O)C)C2=CC(C(F)(F)F)=CC=C2
Synonyms:- 2-[4-(acetylamino)phenoxy]-N-{1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl}acetamide
- Acetamide, 2-[4-(acetylamino)phenoxy]-N-[1-methyl-2-[3-(trifluoromethyl)phenyl]ethyl]-
- Flucetorex [INN:DCF]
- Pm-3944
- Unii-0Jjt8Mq49S
- alpha-((alpha-Methyl-m-(trifluoromethyl)phenethyl)carbamoyl)-p-acetanisidide
- Flucetorex
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Flucetorex
CAS:<p>Flucetorex is a biochemical.</p>Formula:C20H21F3N2O3Color and Shape:SolidMolecular weight:394.39

