CAS 4026-20-4
:2-Hydroxy-3,3-dimethylbutanoic acid
Description:
2-Hydroxy-3,3-dimethylbutanoic acid, also known as HDMBA, is an organic compound characterized by its carboxylic acid functional group and a hydroxyl group attached to a branched carbon chain. This compound features a four-carbon backbone with two methyl groups at the third carbon, contributing to its branched structure. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of both the hydroxyl and carboxylic acid groups imparts polar characteristics, making it soluble in water and various organic solvents. HDMBA is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its unique structure allows for various chemical reactions, including esterification and acylation. Additionally, it may exhibit biological activity, although specific studies on its pharmacological properties are limited. As with many organic acids, it should be handled with care due to its potential corrosive nature and the need for proper safety precautions in laboratory settings.
Formula:C6H12O3
InChI:InChI=1S/C6H12O3/c1-6(2,3)4(7)5(8)9/h4,7H,1-3H3,(H,8,9)
InChI key:InChIKey=FWVNWTNCNWRCOU-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(C(O)=O)O
Synonyms:- Butyric acid, α-hydroxy-β,β-dimethyl-
- Butyric acid, 2-hydroxy-3,3-dimethyl-
- (±)-2-Hydroxy-3,3-dimethylbutanoic acid
- Butanoic acid, 2-hydroxy-3,3-dimethyl-
- 2-Hydroxy-3,3-dimethylbutyric acid
- Butyric acid, 2-hydroxy-3,3-dimethyl-
- 2-Hydroxy-3,3-dimethylbutanoic acid
- 2-hydroxy-3,3-dimethylbutanoic acid
- 3,3-Dimethyl-2-hydroxybutyric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Hydroxy-3,3-dimethylbutanoic acid
CAS:2-Hydroxy-3,3-dimethylbutanoic acidPurity:97%Molecular weight:132.16g/mol2-Hydroxy-3,3-dimethylbutanoic acid
CAS:2-Hydroxy-3,3-dimethylbutanoic acid is an organic compound that is used as a precursor to hypochlorite. It is synthesized by the catalytic oxidation of ethyl formate with a palladium catalyst in an alkaline solution. The resulting 2-hydroxy-3,3-dimethylbutanoic acid has a high yield and can be used as a starting material for the manufacture of sodium hypochlorite and other chlorinating agents. The optical purity of the product can be improved by using ruthenium or copper catalysts in place of palladium.
Formula:C6H12O3Purity:Min. 95%Molecular weight:132.16 g/mol



