CAS 40269-01-0
:methyl 3,4-O-(1-methylethylidene)hexopyranoside
Description:
Methyl 3,4-O-(1-methylethylidene)hexopyranoside, with the CAS number 40269-01-0, is a glycoside derivative characterized by its sugar moiety, which is a hexopyranose, typically derived from glucose or a related sugar. This compound features a methyl group and an isopropylidene group at the 3 and 4 positions of the sugar ring, respectively, which contributes to its stability and solubility properties. The presence of the methoxy group enhances its reactivity and potential applications in organic synthesis. Methyl glycosides like this one are often used in carbohydrate chemistry for various applications, including as intermediates in the synthesis of more complex molecules. The compound is likely to be a white to off-white solid, soluble in polar solvents such as methanol and water, and may exhibit specific optical activity due to its chiral centers. Its unique structural features make it of interest in both synthetic organic chemistry and potential biological applications, although specific biological activity would require further investigation.
Formula:C10H18O6
InChI:InChI=1/C10H18O6/c1-10(2)15-7-5(4-11)14-9(13-3)6(12)8(7)16-10/h5-9,11-12H,4H2,1-3H3
SMILES:CC1(C)OC2C(CO)OC(C(C2O1)O)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 3,4-O-isopropylidene-a-D-galactopyranoside
CAS:<p>Methyl 3,4-O-isopropylidene-a-D-galactopyranoside is a white crystalline powder that is soluble in water. This product is used in the synthesis of complex carbohydrate and glycosylation. It has CAS No. 40269-01-0 and can be custom synthesized to meet your requirements. The purity of this product is over 99%.</p>Formula:C10H18O6Purity:Min. 95%Molecular weight:234.25 g/mol

