CAS 40273-47-0
:3-Fluoropyridine-4-carboxaldehyde
Description:
3-Fluoropyridine-4-carboxaldehyde is an organic compound characterized by its pyridine ring, which contains a fluorine atom at the 3-position and an aldehyde functional group at the 4-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It has a molecular formula that reflects the presence of fluorine, carbon, hydrogen, and nitrogen atoms, contributing to its unique chemical properties. The aldehyde group makes it reactive, particularly in condensation reactions and nucleophilic additions. Additionally, the presence of the fluorine atom can influence the compound's reactivity and polarity, often enhancing its electrophilic character. 3-Fluoropyridine-4-carboxaldehyde is utilized in various synthetic applications, including the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the synthesis of more complex molecules. Its properties, such as boiling point and solubility, can vary based on environmental conditions and the presence of other functional groups in a reaction mixture.
Formula:C6H4FNO
InChI:InChI=1/C6H4FNO/c7-6-3-8-2-1-5(6)4-9/h1-4H
SMILES:c1cncc(c1C=O)F
Synonyms:- 3-Fluoro-4-pyridinecarboxaldehyde
- N,N'-bis(trifluoroacetyl)cystine
- 3-Fluoropyridine-4-Carbaldehyde
- 3-Fluoroisonicotinaldehyde
- 3-Fluoropyridin-4-ylcarboxaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Fluoro-4-pyridinecarboxaldehyde
CAS:Formula:C6H4FNOPurity:97%Color and Shape:LiquidMolecular weight:125.1023-Fluoro-4-pyridinecarbaldehyde
CAS:Formula:C6H4FNOPurity:98%Color and Shape:LiquidMolecular weight:125.10053-Fluoroisonicotinaldehyde
CAS:<p>3-Fluoroisonicotinaldehyde</p>Purity:95%Color and Shape:Pale Yellow LiquidMolecular weight:125.10g/mol3-Fluoropyridine-4-carboxaldehyde
CAS:<p>3-Fluoropyridine-4-carboxaldehyde is a reactivator that can be used in the treatment of bladder cancer. It binds to pyridinium and oxime derivatives, which are present in proteins, to form a reactive intermediate. This intermediate reacts with aldehyde groups on hemoglobin, restoring the oxygen binding capacity of hemoglobin to levels seen in healthy individuals. 3-Fluoropyridine-4-carboxaldehyde has been shown to have anticancer activity against bladder cancer cells and also has potential use as an additive for the treatment of red blood cells.</p>Formula:C6H4FNOPurity:Min. 95%Color and Shape:Colorless Yellow Clear LiquidMolecular weight:125.1 g/mol
