CAS 40279-96-7
:(2R)-2-{[(4-fluorophenyl)sulfonyl]amino}-3-phenylpropanoate
Description:
The chemical substance known as (2R)-2-{[(4-fluorophenyl)sulfonyl]amino}-3-phenylpropanoate, with the CAS number 40279-96-7, is characterized by its specific structural features and functional groups. It contains a chiral center at the second carbon, indicating that it exists in a specific stereoisomeric form. The presence of a sulfonamide group, derived from the 4-fluorophenyl moiety, suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The phenylpropanoate structure indicates that it may exhibit properties typical of esters, such as volatility and solubility in organic solvents. Additionally, the fluorine atom in the para position of the phenyl ring can enhance the compound's lipophilicity and biological activity. Overall, this compound's unique combination of functional groups and stereochemistry may contribute to its reactivity and potential therapeutic applications, making it of interest in various fields, including drug design and synthesis.
Formula:C15H13FNO4S
InChI:InChI=1/C15H14FNO4S/c16-12-6-8-13(9-7-12)22(20,21)17-14(15(18)19)10-11-4-2-1-3-5-11/h1-9,14,17H,10H2,(H,18,19)/p-1/t14-/m1/s1
SMILES:c1ccc(cc1)C[C@H](C(=O)[O-])NS(=O)(=O)c1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2-{[(4-Fluorophenyl)sulfonyl]amino}-3-phenyl-propanoic acid
CAS:Formula:C15H14FNO4SMolecular weight:323.33942-{[(4-Fluorophenyl)sulfonyl]amino}-3-phenylpropanoic acid
CAS:Formula:C15H14FNO4SColor and Shape:SolidMolecular weight:323.342-(4-Fluorophenylsulphamido)-3-phenylpropanoic acid
CAS:2-(4-Fluorophenylsulphamido)-3-phenylpropanoic acid
Molecular weight:323.34g/mol


