CAS 40283-41-8
:2-Amino-4-thiazolecarboxylic acid
Description:
2-Amino-4-thiazolecarboxylic acid, with the CAS number 40283-41-8, is an organic compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing sulfur and nitrogen. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the thiazole ring, contributing to its acidic properties. It is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents, making it useful in various chemical reactions and applications. The presence of the amino and carboxylic acid functional groups allows for potential interactions in biological systems, which may lead to applications in pharmaceuticals or agrochemicals. Additionally, its thiazole moiety is often associated with biological activity, including antimicrobial and antifungal properties. As with many thiazole derivatives, 2-amino-4-thiazolecarboxylic acid may also serve as a building block in the synthesis of more complex molecules in medicinal chemistry.
Formula:C4H3N2O2S
InChI:InChI=1/C4H4N2O2S/c5-4-6-2(1-9-4)3(7)8/h1H,(H2,5,6)(H,7,8)/p-1
SMILES:c1c(C(=O)[O-])[nH]c(=N)s1
Synonyms:- 2-Amino-1,3-thiazole-4-carboxylic acid
- 2-Aminothiazole-4-carboxylicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Aminothiazole-4-carboxylic acid
CAS:Formula:C4H4N2O2SPurity:98%Color and Shape:SolidMolecular weight:144.15182-Amino-1,3-thiazole-4-carboxylic acid
CAS:2-Amino-1,3-thiazole-4-carboxylic acidFormula:C4H4N2O2SPurity:98%Color and Shape: white solidMolecular weight:144.15g/mol2-Amino-thiazole-4-carboxylic acid
CAS:Formula:C4H4N2O2SPurity:95%Color and Shape:SolidMolecular weight:144.152-Amino-4-thiazolecarboxylic acid
CAS:2-Amino-4-thiazolecarboxylic acid is a potent antiviral agent that inhibits influenza virus replication. It has been shown to be effective in vivo against the growth of tumor cells and to inhibit the activity of viral proteases. It also inhibits the activity of human plasma cholinesterase, which may be due to its structural similarity to acetylcholine. 2-Amino-4-thiazolecarboxylic acid is soluble in water and hydrochloric acid, but insoluble in ether or chloroform. This compound has been used as an analytical standard for measuring plasma levels of chloride ions by ion chromatography.
Formula:C4H4N2O2SPurity:Min. 95%Color and Shape:PowderMolecular weight:144.15 g/mol



