CAS 40283-46-3
:2-Amino-5-thiazolecarboxylic acid
Description:
2-Amino-5-thiazolecarboxylic acid, with the CAS number 40283-46-3, is an organic compound characterized by its thiazole ring structure, which incorporates both sulfur and nitrogen atoms. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the thiazole ring, contributing to its acidic and basic properties. It is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents, making it useful in various chemical applications. The presence of the amino and carboxylic acid functional groups allows for potential interactions in biological systems, suggesting its relevance in pharmaceutical research and development. Additionally, 2-amino-5-thiazolecarboxylic acid may exhibit biological activity, including antimicrobial or anti-inflammatory properties, which are of interest in medicinal chemistry. Its stability and reactivity can be influenced by environmental conditions such as pH and temperature, making it a compound of interest for further study in both synthetic and applied chemistry contexts.
Formula:C4H4N2O2S
InChI:InChI=1S/C4H4N2O2S/c5-4-6-1-2(9-4)3(7)8/h1H,(H2,5,6)(H,7,8)
InChI key:InChIKey=ZFMRDDYYJJCBKC-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1SC(N)=NC1
Synonyms:- 2-Amino-5-thiazolecarboxylic acid
- 2-Aminothiazole-5-Carboxylic Acid
- 2-Aminothiazole-5-Formic Acid
- 5-Thiazolecarboxylic acid, 2-amino-
- NSC 239729
- 2-Amino-1,3-thiazole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-AMINOTHIAZOLE-5-CARBOXYLIC ACID
CAS:Formula:C4H4N2O2SPurity:95%Color and Shape:SolidMolecular weight:144.15182-Amino-1,3-thiazole-5-carboxylic acid
CAS:2-Amino-1,3-thiazole-5-carboxylic acidPurity:95%Color and Shape:White To Yellow PowderMolecular weight:144.15g/mol2-Aminothiazole-5-carboxylic acid
CAS:Formula:C4H4N2O2SPurity:95%Color and Shape:SolidMolecular weight:144.152-Aminothiazole-5-carboxylic acid
CAS:2-Aminothiazole-5-carboxylic acid is a synthetic compound that is currently being investigated as a potential anticancer agent. 2-Aminothiazole-5-carboxylic acid has shown anticancer activity in clinical studies, with an increase in the number of cancer cells killed and a decrease in the number of cancer cells surviving after treatment. The mechanism of action for this drug is not well understood, but it may be due to its ability to inhibit cellular processes such as DNA synthesis and protein synthesis.
2-Aminothiazole-5-carboxylic acid does not show significant toxicity at therapeutic doses, although it can cause some side effects including nausea, vomiting, constipation, diarrhea, headaches, and fever.Formula:C4H4N2O2SPurity:Min. 95%Color and Shape:PowderMolecular weight:144.15 g/molRef: 3D-FA36283
Discontinued product



