CAS 4029-41-8
:N-(3-chloroquinoxalin-2-yl)-4-methylbenzenesulfonamide
Description:
N-(3-chloroquinoxalin-2-yl)-4-methylbenzenesulfonamide, with the CAS number 4029-41-8, is a chemical compound that features a sulfonamide functional group attached to a quinoxaline derivative. This compound typically exhibits characteristics common to sulfonamides, such as antibacterial properties, due to the presence of the sulfonamide moiety. The quinoxaline structure contributes to its potential biological activity, as quinoxalines are known for their roles in medicinal chemistry, particularly in the development of pharmaceuticals. The chlorine substituent at the 3-position of the quinoxaline ring may influence the compound's reactivity and biological interactions. Additionally, the presence of the 4-methyl group on the benzene ring can affect the compound's lipophilicity and solubility, which are important factors in drug design and efficacy. Overall, this compound may be of interest in research related to antimicrobial agents or other therapeutic applications, although specific biological activity would require further investigation.
Formula:C15H12ClN3O2S
InChI:InChI=1/C15H12ClN3O2S/c1-10-6-8-11(9-7-10)22(20,21)19-15-14(16)17-12-4-2-3-5-13(12)18-15/h2-9H,1H3,(H,18,19)
SMILES:Cc1ccc(cc1)S(=O)(=O)N=c1c(Cl)nc2ccccc2[nH]1
Synonyms:- benzenesulfonamide, N-(3-chloro-2-quinoxalinyl)-4-methyl-
- N-(3-Chloro-quinoxalin-2-yl)-4-methyl-benzenesulfonamide
- N-(3-Chloroquinoxalin-2-yl)-4-methylbenzenesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(3-CHLORO-QUINOXALIN-2-YL)-4-METHYL-BENZENESULFONAMIDE
CAS:Formula:C15H12ClN3O2SPurity:95%Color and Shape:SolidMolecular weight:333.7927N-(3-Chloroquinoxalin-2-yl)-4-methylbenzenesulfonamide
CAS:N-(3-Chloroquinoxalin-2-yl)-4-methylbenzenesulfonamidePurity:95%Molecular weight:333.8g/molN-(3-Chloroquinoxalin-2-yl)-4-methylbenzenesulfonamide
CAS:Purity:95.0%Molecular weight:333.7900085449219N-(3-Chloroquinoxalin-2-yl)-4-methylbenzenesulfonamide
CAS:<p>3-Chloroquinoxaline-2-carboxylic acid (3CQC) is a halogen atom, oxadiazole, benzene, alkoxycarbonyl, alkoxy, cyano, trifluoromethyl, dihedral and halogen. 3CQC is used as a chemical intermediate in organic synthesis. It can be used as a starting material for the synthesis of other organic compounds and pharmaceuticals. 3CQC has been found to inhibit bacterial growth by inhibiting RNA polymerase. This compound also inhibits protein synthesis by binding to the ribosome's 50S subunit and prevents the production of proteins vital for cell division.</p>Formula:C15H12ClN3O2SPurity:Min. 95%Molecular weight:333.79 g/mol



