CAS 4029-69-0

3,16-bis(acetyloxy)-14-hydroxybufa-20,22-dienolide

Description:

3,16-bis(acetyloxy)-14-hydroxybufa-20,22-dienolide, with the CAS number 4029-69-0, is a complex organic compound belonging to the class of bufadienolides, which are steroidal compounds derived from toads. This substance is characterized by its unique structural features, including two acetoxy groups at the 3 and 16 positions and a hydroxyl group at the 14 position, contributing to its biological activity. The presence of the dienolide structure indicates a conjugated system that may enhance its reactivity and potential pharmacological properties. Bufadienolides are known for their cardiotonic effects and have been studied for their potential therapeutic applications, including anti-cancer and anti-inflammatory activities. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it an interesting subject for further research in medicinal chemistry and pharmacology. As with many natural products, the specific biological effects and mechanisms of action of this compound would require detailed investigation through experimental studies.

Formula: C₂₈H₃₈O₇

InChI: InChI=1/C28H38O7/c1-16(29)34-20-9-11-26(3)19(13-20)6-7-22-21(26)10-12-27(4)25(18-5-8-24(31)33-15-18)23(35-17(2)30)14-28(22,27)32/h5,8,15,19-23,25,32H,6-7,9-14H2,1-4H3

SMILES: CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C(c4ccc(=O)oc4)C(CC32O)OC(=O)C)C1

3-O-Acetylbufotalin

CAS: 4029-69-0

Formula: C₂₈H₃₈O₇

Molecular weight: 486.61

Ref: 7W-GY0947

3-O-Acetylbufotalin

CAS: 4029-69-0

Formula: C₂₈H₃₈O₇

Purity: 95%~99%

Molecular weight: 486.605

Ref: BP-BP2069

o-Acetylbufotalin

CAS: 4029-69-0

o-Acetylbufotalin is a naturally derived steroidal compound, which is extracted from the venom of toads belonging to the Bufonidae family. This compound is part of the bufadienolide class and exhibits its mode of action primarily through the inhibition of Na⁺/K⁺-ATPase. By interfering with these ion pumps, o-Acetylbufotalin influences ion equilibrium across the cell membrane, which can lead to increased intracellular calcium levels and subsequent effects on cardiac muscle contraction.

Formula: C₂₈H₃₈O₇

Purity: Min. 95%

Molecular weight: 486.6 g/mol

Ref: 3D-EAA02969

3-O-Acetylbufotalin

CAS: 4029-69-0

3-O-Acetylbufotalin is a derivate of bufadienolide with anti-cancer activity.

Formula: C₂₈H₃₈O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 486.6

Ref: TM-T10116