CAS 40290-63-9

methyl N-(tert-butoxycarbonyl)phenylalanylmethioninate

Description:

Methyl N-(tert-butoxycarbonyl)phenylalanylmethioninate, with the CAS number 40290-63-9, is a synthetic compound commonly used in peptide chemistry and drug development. This substance features a methyl ester functional group, which enhances its solubility and stability, making it suitable for various biochemical applications. The tert-butoxycarbonyl (Boc) group serves as a protective group for the amino acid phenylalanine, allowing for selective reactions during peptide synthesis. The presence of methionine in its structure contributes to its role in protein synthesis and biological activity. This compound is typically characterized by its solid state at room temperature and may exhibit specific melting and boiling points, depending on its purity and formulation. Its reactivity is influenced by the functional groups present, making it a versatile intermediate in organic synthesis. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use in laboratory settings.

Formula: C₂₀H₃₀N₂O₅S

InChI: InChI=1/C20H30N2O5S/c1-20(2,3)27-19(25)22-16(13-14-9-7-6-8-10-14)17(23)21-15(11-12-28-5)18(24)26-4/h6-10,15-16H,11-13H2,1-5H3,(H,21,23)(H,22,25)

SMILES: CC(C)(C)OC(=NC(Cc1ccccc1)C(=NC(CCSC)C(=O)OC)O)O

Synonyms:

• methionine, N-[(1,1-dimethylethoxy)carbonyl]phenylalanyl-, methyl ester