CAS 402958-25-2
:(1S,3aR,6aS)-Octahydrocyclopenta[c]pyrrole-1-carboxylic acid ethyl ester
Description:
(1S,3aR,6aS)-Octahydrocyclopenta[c]pyrrole-1-carboxylic acid ethyl ester is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopentane ring fused to a pyrrole moiety. This compound features a carboxylic acid functional group esterified with an ethyl group, contributing to its reactivity and solubility properties. The stereochemistry indicated by the (1S,3aR,6aS) configuration suggests specific spatial arrangements of its atoms, which can influence its biological activity and interactions with other molecules. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of multiple chiral centers also implies that the compound may exist in different stereoisomeric forms, which can have varying effects in biological systems. Additionally, its molecular weight and solubility characteristics would be relevant for applications in drug formulation and development. Overall, this compound represents a complex structure with potential utility in various chemical and pharmaceutical applications.
Formula:C10H17NO2
InChI:InChI=1S/C10H17NO2/c1-2-13-10(12)9-8-5-3-4-7(8)6-11-9/h7-9,11H,2-6H2,1H3/t7-,8-,9-/m0/s1
SMILES:CCOC(=O)[C@@H]1[C@H]2CCC[C@H]2CN1
Synonyms:- Octahydro-cyclopentapyrrole-1-carboxylic acid ethyl ester
- (1S,3AR,6AS)-Octahydro-cyclopenta[c]pyrrole-1-carboxylic acid ethyl ester
- (1S,3Ar,6As)-Ethyl Octahydrocyclopenta[C]Pyrrole-1-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1S,3aR,6aS)-Ethyl octahydrocyclopenta[c]pyrrole-1-carboxylate
CAS:Formula:C10H17NO2Molecular weight:183.2475

