CAS 40299-87-4

2-bromo-1-(morpholin-4-yl)ethanone

Description:

2-bromo-1-(morpholin-4-yl)ethanone is an organic compound characterized by the presence of a bromine atom and a morpholine ring. It features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The morpholine moiety, a six-membered ring containing both oxygen and nitrogen, enhances the compound's solubility in polar solvents and may influence its biological activity. This compound is typically used in medicinal chemistry and may serve as an intermediate in the synthesis of various pharmaceuticals. Its structure suggests potential reactivity due to the electrophilic nature of the carbonyl group and the presence of the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, the morpholine ring can engage in hydrogen bonding, affecting the compound's physical properties, such as boiling point and solubility. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental concerns. Overall, 2-bromo-1-(morpholin-4-yl)ethanone is a versatile compound with significant implications in chemical research and development.

Formula: C₆H₁₀BrNO₂

InChI: InChI=1/C6H10BrNO2/c7-5-6(9)8-1-3-10-4-2-8/h1-5H2

SMILES: C1COCCN1C(=O)CBr

Synonyms:

• Ethanone, 2-bromo-1-(4-morpholinyl)-
• Chembrdg-Bb 4023671
• 2-Bromo-1-(morpholin-4-yl)ethanone

2-Bromo-1-morpholinoethanone

CAS: 40299-87-4

Formula: C₆H₁₀BrNO₂

Purity: 95%

Color and Shape: No data available.

Molecular weight: 208.055

Ref: 10-F223144

2-Bromo-1-(4-morpholinyl)ethanone

CAS: 40299-87-4

Formula: C₆H₁₀BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.0531

Ref: IN-DA0037H2

2-Bromo-1-(morpholin-4-yl)ethanone

CAS: 40299-87-4

2-Bromo-1-(morpholin-4-yl)ethanone

Purity: 95%

Molecular weight: 208.055g/mol

Ref: 54-OR73477