CAS 403-18-9

4-fluoro-3-iodobenzoic acid

Description:

4-Fluoro-3-iodobenzoic acid is an aromatic carboxylic acid characterized by the presence of both a fluorine and an iodine atom on the benzene ring. Specifically, the fluorine atom is located at the para position (4-position) and the iodine atom at the meta position (3-position) relative to the carboxylic acid group. This compound typically appears as a solid at room temperature and is known for its moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The presence of halogens (fluorine and iodine) can influence the compound's reactivity, stability, and interaction with biological systems, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, the unique electronic properties imparted by the halogens can affect the compound's acidity and overall chemical behavior. Safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₇H₄FIO₂

InChI: InChI=1/C7H4FIO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11)

SMILES: c1cc(c(cc1C(=O)O)I)F

Synonyms:

• Benzoic Acid, 4-Fluoro-3-Iodo-
• 4-Fluoro-3-iodobenzoic acid

4-Fluoro-3-iodobenzoic acid

CAS: 403-18-9

Formula: C₇H₄FIO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 266.0083

Ref: IN-DA00C6X7

4-Fluoro-3-iodobenzoic acid

CAS: 403-18-9

4-Fluoro-3-iodobenzoic acid

Formula: C₇H₄FIO₂

Purity: ≥95%

Color and Shape: white powder

Molecular weight: 266.01g/mol

Ref: 54-PC9217

4-Fluoro-3-iodobenzoic acid

CAS: 403-18-9

4-Fluoro-3-iodobenzoic acid is an aromatic amine that is used as a reagent in organic chemistry. It is a nontoxic chemical that has no known harmful effects to humans. 4-Fluoro-3-iodobenzoic acid can be synthesized by the reaction of diethylaminoethyl chloride with 4-fluorobenzoic acid and sodium iodide. This compound yields a mixture of alkylbenzenes, hydrocarbons, and aromatic compounds when heated with solvents such as diethyl ether or chloroform.

Formula: C₇H₄FIO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 266.01 g/mol

Ref: 3D-FF67385

4-Fluoro-3-iodobenzoic acid

CAS: 403-18-9

Formula: C₇H₄FIO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 266.01

Ref: 10-F050127