CymitQuimica logo

CAS 40302-35-0

:

2-(1H-indol-3-ylmethylidene)-5,5-dimethylcyclohexane-1,3-dione

Description:
2-(1H-indol-3-ylmethylidene)-5,5-dimethylcyclohexane-1,3-dione, identified by its CAS number 40302-35-0, is an organic compound characterized by its complex structure that includes an indole moiety and a cyclohexane-1,3-dione framework. This compound typically exhibits a yellow to orange color, indicative of its potential for chromophoric properties. It is likely to be soluble in organic solvents such as ethanol and dimethyl sulfoxide, while exhibiting limited solubility in water due to its hydrophobic characteristics. The presence of the indole group suggests potential biological activity, as indole derivatives are known for their roles in pharmaceuticals and natural products. The compound may also display interesting reactivity due to the presence of the diketone functional groups, which can participate in various chemical reactions, including condensation and Michael addition. Its unique structure and properties make it a subject of interest in organic synthesis and medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C17H17NO2
InChI:InChI=1/C17H17NO2/c1-17(2)8-15(19)13(16(20)9-17)7-11-10-18-14-6-4-3-5-12(11)14/h3-7,10,18H,8-9H2,1-2H3
SMILES:CC1(C)CC(=O)C(=Cc2c[nH]c3ccccc23)C(=O)C1
Synonyms:
  • 2-(1H-indol-3-ylmethylene)-5,5-dimethylcyclohexane-1,3-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.