CAS 40306-24-9

(4-chloro-3-nitrophenyl)(4-methylphenyl)methanone

Description:

(4-chloro-3-nitrophenyl)(4-methylphenyl)methanone, with the CAS number 40306-24-9, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, specifically a carbonyl group (C=O) bonded to a phenyl ring, which is further substituted with both a chloro and a nitro group on one aromatic ring and a methyl group on the other. This compound exhibits properties typical of aromatic ketones, including stability and potential reactivity due to the presence of electron-withdrawing groups like the nitro and chloro substituents. These groups can influence the compound's electronic properties, making it useful in various chemical reactions, including electrophilic aromatic substitution. The presence of these substituents may also affect its solubility, melting point, and boiling point, as well as its reactivity in biological systems. Overall, this compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or materials science due to its unique structural features.

Formula: C₁₄H₁₀ClNO₃

InChI: InChI=1/C14H10ClNO3/c1-9-2-4-10(5-3-9)14(17)11-6-7-12(15)13(8-11)16(18)19/h2-8H,1H3

SMILES: Cc1ccc(cc1)C(=O)c1ccc(c(c1)N(=O)=O)Cl

Synonyms:

• Methanone, (4-chloro-3-nitrophenyl)(4-methylphenyl)

(4-Chloro-3-nitrophenyl)(p-tolyl)methanone

CAS: 40306-24-9

Formula: C₁₄H₁₀ClNO₃

Color and Shape: Solid

Molecular weight: 275.6871

Ref: IN-DA003L5D

4-Chloro-4'-methyl-3-nitrobenzophenone

Controlled Product

CAS: 40306-24-9

Applications 4-Chloro-4'-methyl-3-nitrobenzophenone is a benzophenone derivative used in the preparation of nitrogen-containing heterocycles.
References Orlov, V.Y. et al.: Azot. Geterot. Alkal., 1, 452 (2001);

Formula: C₁₄H₁₀ClNO₃

Color and Shape: Neat

Molecular weight: 275.69

Ref: TR-C369385