CAS 40311-13-5
:6-fluoro-2-methyl-1H-indole
Description:
6-Fluoro-2-methyl-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 6-position and a methyl group at the 2-position contributes to its unique properties. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The fluorine substituent can enhance lipophilicity and metabolic stability, making it an interesting candidate for drug design. Additionally, 6-fluoro-2-methyl-1H-indole may exhibit fluorescence, which can be useful in various analytical applications. Its reactivity can be influenced by the electron-withdrawing nature of the fluorine atom, affecting its interactions in chemical reactions. As with many indole derivatives, it may also participate in various biological processes, making it a subject of interest in research related to neurochemistry and pharmacology. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C9H8FN
InChI:InChI=1/C9H8FN/c1-6-4-7-2-3-8(10)5-9(7)11-6/h2-5,11H,1H3
SMILES:Cc1cc2ccc(cc2[nH]1)F
Synonyms:- 6-Fluoro-2-methylindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Fluoro-2-methyl-1H-indole
CAS:<p>6-Fluoro-2-methyl-1H-indole</p>Purity:97%Molecular weight:149.16g/mol6-Fluoro-2-methylindole
CAS:<p>6-Fluoro-2-methylindole is a member of the group of aromatic ketones. It is an organic compound that can be synthetized from 2,6-dichloroindole and methyl iodide. There are two types of photodimerization reactions for 6-fluoro-2-methylindole: one is an aerobic reaction and the other is an anaerobic reaction. The mechanistic study of 6-fluoro-2-methylindole has been investigated using bond cleavage and transformation reactions. This organic compound reacts with amines to form polycycles with high yields. It also undergoes Diastereomeric Control in chemistry.</p>Formula:C9H8FNPurity:Min. 95%Color and Shape:Brown PowderMolecular weight:149.16 g/mol
