CAS 4032-94-4

2,4-dimethyloctane

Description:

2,4-Dimethyloctane is an organic compound classified as an alkane, specifically a branched-chain hydrocarbon. It features a total of ten carbon atoms and is characterized by the presence of two methyl groups attached to the second and fourth carbon atoms of the octane chain. This structural arrangement contributes to its physical properties, such as a relatively high boiling point and low volatility compared to straight-chain alkanes of similar molecular weight. 2,4-Dimethyloctane is typically a colorless liquid at room temperature and is insoluble in water but soluble in organic solvents. Its chemical formula is C10H22, and it is primarily used in research and industrial applications, including as a reference compound in studies of fuel properties and combustion characteristics. The compound's branched structure can influence its reactivity and interaction with other substances, making it of interest in various chemical processes. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₀H₂₂

InChI: InChI=1/C10H22/c1-5-6-7-10(4)8-9(2)3/h9-10H,5-8H2,1-4H3

SMILES: CCCCC(C)CC(C)C

Synonyms:

• Octane, 2,4-Dimethyl-

2,4-Dimethyloctane

CAS: 4032-94-4

2,4-Dimethyloctane

Formula: C₁₀H₂₂

Purity: By gc: 97.8% by area (Typical Value in Batch COA)

Color and Shape: clear. colourless liquid

Molecular weight: 142.28g/mol

Ref: 54-OR54625