CAS 4033-39-0
:L-α,β-Diaminopropionic acid
Description:
L-α,β-Diaminopropionic acid, also known as L-DAP, is a non-proteinogenic amino acid characterized by the presence of two amino groups (-NH2) and one carboxylic acid group (-COOH) in its structure. This compound is a derivative of propionic acid and is notable for its role in various biochemical processes, particularly in the synthesis of certain peptides and proteins. L-DAP is typically a white crystalline solid that is soluble in water, reflecting its polar nature due to the amino and carboxyl functional groups. It has a relatively high melting point, indicative of strong intermolecular interactions, such as hydrogen bonding. L-DAP is of interest in research and biotechnology, particularly in studies related to amino acid metabolism and the development of novel therapeutic agents. Its CAS number, 4033-39-0, is used for identification in chemical databases and regulatory contexts. Overall, L-α,β-Diaminopropionic acid serves as a valuable compound in both academic research and potential industrial applications.
Formula:C3H8N2O2
InChI:InChI=1S/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)/t2-/m0/s1
InChI key:InChIKey=PECYZEOJVXMISF-REOHCLBHSA-N
SMILES:[C@@H](C(O)=O)(CN)N
Synonyms:- (2S)-2,3-Diaminopropanoic acid
- (S)-2,3-Diaminopropanoic acid
- (S)-2,3-Diaminopropionic acid
- 3-Amino-<span class="text-smallcaps">L</span>-alanine
- 3-amino-L-alanine
- <span class="text-smallcaps">L</span>-2,3-Diaminopropanoic acid
- <span class="text-smallcaps">L</span>-2,3-Diaminopropionic acid
- <span class="text-smallcaps">L</span>-Alanine, 3-amino-
- <span class="text-smallcaps">L</span>-Diaminopropanoic acid
- <span class="text-smallcaps">L</span>-α,β-Diaminopropionic acid
- <span class="text-smallcaps">L</span>-β-Aminoalanine
- L-Alanine, 3-amino-
- Nsc 115849
- Propionic acid, 2,3-diamino-, <span class="text-smallcaps">L</span>-
- Propionic acid, 2,3-diamino-, L-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Diaminopropionic acid
CAS:2,3-Diaminopropionic acid (L-2,3-Diaminopropionic acid) is an amino acid that is a precursor of antibiotics and staphyloferrin B a siderophore produced byFormula:C3H8N2O2Purity:99.61% - 99.90%Color and Shape:SolidMolecular weight:104.11L-2,3-Diaminopropionicacid
CAS:L-2,3-Diaminopropionic acid is a diamine with an asymmetric carbon atom. It has been used to synthesize antimicrobial peptides and has also shown hemolytic activity in vitro. L-2,3-Diaminopropionic acid is stable when exposed to water vapor, which may make it useful for the treatment of cancer tissues. This molecule has been shown to have significant cytotoxicity against human leukemia cells and is able to inhibit the growth of various bacteria by inhibiting protein synthesis in the ribosome. L-2,3-Diaminopropionic acid also inhibits the enzyme enolase and reduces the production of ATP in cells.Formula:C3H8N2O2Purity:Min. 95%Molecular weight:104.11 g/mol



