CAS 40332-16-9

1H-benzimidazol-1-ylacetic acid

Description:

1H-benzimidazol-1-ylacetic acid, with the CAS number 40332-16-9, is an organic compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features an acetic acid functional group attached to the nitrogen of the benzimidazole, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound exhibits biological activity, making it of interest in pharmaceutical research, particularly for its potential applications in medicinal chemistry. Its structure allows for various interactions with biological targets, which can lead to diverse pharmacological effects. Additionally, 1H-benzimidazol-1-ylacetic acid may participate in various chemical reactions, including esterification and amidation, due to its functional groups, making it a versatile intermediate in organic synthesis.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c12-9(13)5-11-6-10-7-3-1-2-4-8(7)11/h1-4,6H,5H2,(H,12,13)

SMILES: c1ccc2c(c1)ncn2CC(=O)O

Synonyms:

• 1H-Benzimidazole-1-acetic acid
• 2-(1H-benzimidazol-1-yl)acetic acid

1H-benzimidazol-1-ylacetic acid

CAS: 40332-16-9

Formula: C₉H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.1720

Ref: IN-DA0035YO

(1H-Benzimidazol-1-yl)acetic acid

CAS: 40332-16-9

(1H-Benzimidazol-1-yl)acetic acid

Purity: 98%

Color and Shape: Brown Solid

Molecular weight: 176.17g/mol

Ref: 54-OR7034

Benzoimidazol-1-yl-acetic acid

CAS: 40332-16-9

Formula: C₉H₈N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 176.175

Ref: 10-F028929