CAS 40336-81-0
:4-(aminomethyl)-N,N-diethylaniline
Description:
4-(Aminomethyl)-N,N-diethylaniline, also known by its CAS number 40336-81-0, is an organic compound that belongs to the class of amines and anilines. It features a diethylamino group and an aminomethyl substituent on the aromatic ring, which contributes to its chemical reactivity and potential applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and may exhibit moderate solubility in water due to the presence of the amino group. The presence of both amine and aromatic functionalities allows it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it useful in the synthesis of dyes, pharmaceuticals, and other organic compounds. Additionally, safety precautions should be taken when handling this substance, as it may pose health risks, including skin and respiratory irritation. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory settings.
Formula:C11H18N2
InChI:InChI=1/C11H18N2/c1-3-13(4-2)11-7-5-10(9-12)6-8-11/h5-8H,3-4,9,12H2,1-2H3
SMILES:CCN(CC)c1ccc(cc1)CN
Synonyms:- Benzenemethanamine, 4-(diethylamino)-
- 4-(Aminomethyl)-N,N-diethylaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-DIETHYLAMINOBENZYLAMINE
CAS:Formula:C11H18N2Purity:95%Color and Shape:LiquidMolecular weight:178.27404-(Aminomethyl)-N,N-Diethylaniline
CAS:4-(Aminomethyl)-N,N-DiethylanilinePurity:95%Molecular weight:178.27g/mol4-Diethylaminobenzylamine
CAS:4-Diethylaminobenzylamine is a pharmacophore that binds to cannabinoid receptors. It has been shown to have anticancer activity in vitro and in vivo. 4-Diethylaminobenzylamine binds to the cannabinoid receptors, which are expressed in various tissues of the body, including the brain and nervous system. The affinity of this compound for these receptors has been shown by its ability to inhibit cancer cell growth in vitro and in vivo. 4-Diethylaminobenzylamine has also been shown to be a functional inhibitor of uptake of serotonin and dopamine into rat brain synaptosomes. This drug is being studied as a possible treatment for diseases such as sclerosis, because it may help regulate the production of cytokines that contribute to inflammation.Formula:C11H18N2Purity:90%Color and Shape:PowderMolecular weight:178.27 g/mol(4-Aminomethylphenyl)diethylamine
CAS:Formula:C11H18N2Purity:95%Color and Shape:Solid, No data available.Molecular weight:178.279



