CAS 40340-41-8

5-(chloromethyl)-3-methylisoxazole

Description:

5-(Chloromethyl)-3-methylisoxazole is a heterocyclic organic compound characterized by its isoxazole ring, which consists of a five-membered ring containing three carbon atoms, one nitrogen atom, and one oxygen atom. The presence of a chloromethyl group at the 5-position and a methyl group at the 3-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly in nucleophilic substitution reactions due to the electrophilic nature of the chloromethyl group. The isoxazole moiety can participate in various chemical transformations, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, although specific biological properties would depend on the context of its use and the presence of other functional groups in related compounds. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₅H₆ClNO

InChI: InChI=1/C5H6ClNO/c1-4-2-5(3-6)8-7-4/h2H,3H2,1H3

SMILES: Cc1cc(CCl)on1

Synonyms:

• 5-(Chloromethyl)-3-Methyl-1,2-Oxazole
• Isoxazole, 5-(Chloromethyl)-3-Methyl-

Isoxazole, 5-(chloromethyl)-3-methyl-

CAS: 40340-41-8

Formula: C₅H₆ClNO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 131.5602

Ref: IN-DA00I7WT

5-(Chloromethyl)-3-methylisoxazole

CAS: 40340-41-8

5-(Chloromethyl)-3-methylisoxazole

Purity: 98%

Molecular weight: 131.56g/mol

Ref: 54-OR78033

5-(Chloromethyl)-3-methylisoxazole

CAS: 40340-41-8

Formula: C₅H₆ClNO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 131.56

Ref: 10-F237701