CAS 40348-74-1
:1,2-Ethanediol, 1-phenyl-, 2-(4-methylbenzenesulfonate)
Description:
1,2-Ethanediol, 1-phenyl-, 2-(4-methylbenzenesulfonate), with CAS number 40348-74-1, is an organic compound characterized by its structure, which includes a phenyl group and a sulfonate moiety. This compound typically exhibits properties associated with both alcohols and sulfonates, such as solubility in polar solvents due to the presence of the hydroxyl group and the sulfonate's ionic character. It may be utilized in various chemical applications, including as an intermediate in organic synthesis or in the formulation of specialty chemicals. The presence of the sulfonate group can enhance its reactivity and solubility, making it useful in various industrial processes. Additionally, the compound may exhibit specific physical properties such as a moderate boiling point and viscosity, influenced by its molecular structure. Safety data sheets should be consulted for handling and storage guidelines, as compounds with sulfonate groups can sometimes pose environmental or health risks. Overall, this compound represents a unique combination of functional groups that can be leveraged in diverse chemical applications.
Formula:C15H16O4S
InChI:InChI=1S/C15H16O4S/c1-12-7-9-14(10-8-12)20(17,18)19-11-15(16)13-5-3-2-4-6-13/h2-10,15-16H,11H2,1H3
InChI key:InChIKey=IOTJIFRGXYQHAQ-UHFFFAOYSA-N
SMILES:S(OCC(O)C1=CC=CC=C1)(=O)(=O)C2=CC=C(C)C=C2
Synonyms:- 2-[(4-Methylbenzenesulfonyl)oxy]-1-phenylethan-1-ol
- 2-Hydroxy-2-phenylethyl 4-methylbenzenesulfonate
- 1,2-Ethanediol, 1-phenyl-, 2-p-toluenesulfonate
- 1,2-Ethanediol, 1-phenyl-, 2-(4-methylbenzenesulfonate)
- 1,2-Ethanediol, phenyl-, 2-p-toluenesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,2-Ethanediol, 1-phenyl-, 2-(4-methylbenzenesulfonate)
CAS:Formula:C15H16O4SMolecular weight:292.35012-p-Toluenesulfonate 1-Phenyl-d5-1,2-ethanediol
CAS:Controlled ProductApplications 2-p-Toluenesulfonate 1-Phenyl-d5-1,2-ethanediol is an intermediate in the synthesis of rac Mirabegron-d5 (M364902), which is a potent bladder relaxant and reagent for diabetes remedy.
Formula:C15D5H11O4SColor and Shape:NeatMolecular weight:297.381

