CymitQuimica logo

CAS 403502-85-2

:

(6R,7S)-7-Phenyl-1-azabicyclo[4.2.0]octan-8-one

Description:
(6R,7S)-7-Phenyl-1-azabicyclo[4.2.0]octan-8-one, with the CAS number 403502-85-2, is a bicyclic compound characterized by its unique azabicyclo structure, which incorporates a nitrogen atom into a bicyclic framework. This compound features a phenyl group at the 7-position, contributing to its aromatic properties and potential interactions in biological systems. The stereochemistry indicated by the (6R,7S) configuration suggests specific spatial arrangements of its substituents, which can significantly influence its pharmacological activity and interactions with biological targets. The presence of a ketone functional group at the 8-position adds to its reactivity and potential for forming hydrogen bonds. Such compounds are often of interest in medicinal chemistry due to their structural complexity and potential therapeutic applications, particularly in the development of novel drugs. The specific stereochemistry and functional groups present in (6R,7S)-7-Phenyl-1-azabicyclo[4.2.0]octan-8-one may also affect its solubility, stability, and overall biological activity.
Formula:C13H15NO
InChI:InChI=1S/C13H15NO/c15-13-12(10-6-2-1-3-7-10)11-8-4-5-9-14(11)13/h1-3,6-7,11-12H,4-5,8-9H2/t11-,12+/m1/s1
InChI key:InChIKey=BGCURPUAMJAFSI-NEPJUHHUSA-N
SMILES:O=C1[C@H]([C@@]2(N1CCCC2)[H])C3=CC=CC=C3
Synonyms:
  • 1-Azabicyclo[4.2.0]octan-8-one, 7-phenyl-, (6R,7S)-
  • (6R,7S)-7-Phenyl-1-azabicyclo[4.2.0]octan-8-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.