CymitQuimica logo

CAS 403519-98-2

:

(2R)-2-amino-2-methyl-pent-4-ynoic acid

Description:
(2R)-2-amino-2-methyl-pent-4-ynoic acid, also known as a derivative of amino acids, is characterized by its unique structure that includes an alkyne functional group. This compound features a chiral center at the second carbon, which contributes to its stereochemistry, specifically the (R) configuration. The presence of both an amino group (-NH2) and a carboxylic acid group (-COOH) classifies it as an amino acid, making it relevant in biochemical contexts. The alkyne group introduces a degree of unsaturation, which can influence its reactivity and interactions with other molecules. This compound is typically soluble in polar solvents due to its ionic and polar functional groups. Its potential applications may include roles in synthetic organic chemistry, biochemistry, and possibly as a building block in pharmaceuticals. The specific properties, such as melting point, boiling point, and solubility, would depend on the conditions and purity of the substance. Overall, (2R)-2-amino-2-methyl-pent-4-ynoic acid is a versatile compound with significant implications in various chemical and biological fields.
Formula:C6H9NO2
InChI:InChI=1/C6H9NO2/c1-3-4-6(2,7)5(8)9/h1H,4,7H2,2H3,(H,8,9)/t6-/m1/s1
SMILES:C#CC[C@](C)(C(=O)O)N
Synonyms:
  • (2R)-2-amino-2-methylpent-4-ynoic acid
  • 403519-98-2
  • 4-pentynoic acid, 2-amino-2-methyl-, (2R)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.