CAS 40359-30-6
:(2-formyl-6-methoxyphenoxy)acetic acid
Description:
(2-formyl-6-methoxyphenoxy)acetic acid, with the CAS number 40359-30-6, is an organic compound characterized by its functional groups and structural features. It contains a phenoxy group, which is a phenol derivative where a hydrogen atom is replaced by an acetic acid moiety, and an aldehyde group (formyl) at the 2-position of the aromatic ring. The presence of a methoxy group at the 6-position enhances its solubility and reactivity. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its chemical properties are influenced by the electron-donating methoxy group and the electron-withdrawing formyl group, which can affect its reactivity in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. As with many organic compounds, safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.
Formula:C10H10O5
InChI:InChI=1/C10H10O5/c1-14-8-4-2-3-7(5-11)10(8)15-6-9(12)13/h2-5H,6H2,1H3,(H,12,13)
SMILES:COc1cccc(C=O)c1OCC(=O)O
Synonyms:- Acetic acid, 2-(2-formyl-6-methoxyphenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-Formyl-6-methoxyphenoxy)acetic acid
CAS:Formula:C10H10O5Purity:95%Color and Shape:SolidMolecular weight:210.18342-(2-Formyl-6-methoxyphenoxy)acetic acid
CAS:2-(2-Formyl-6-methoxyphenoxy)acetic acidPurity:95%Molecular weight:210.19g/mol2-(2-Formyl-6-methoxyphenoxy)acetic acid
CAS:2-(2-Formyl-6-methoxyphenoxy)acetic acid is a white crystalline solid that occurs as a monomer, dimer, or polymer. It has an asymmetric center and the molecule can exist in four different conformations. When it is crystallized from water, the dihydrate form is obtained; when the substance is heated to produce the anhydrous form, it becomes cyclic and rotates around its central axis. The compound has a centrosymmetric conformation and it can be classified as unidentate because it has only one functional group per molecule. 2-(2-Formyl-6-methoxyphenoxy)acetic acid also has a carboxylate group on its side chain.Formula:C10H10O5Purity:Min. 95%Molecular weight:210.19 g/mol



