CAS 4036-83-3

2-morpholin-4-yl-5-nitrobenzoic acid

Description:

2-Morpholin-4-yl-5-nitrobenzoic acid, with the CAS number 4036-83-3, is a chemical compound characterized by its unique structure, which includes a morpholine ring and a nitro group attached to a benzoic acid moiety. This compound typically appears as a solid and is soluble in polar organic solvents. It exhibits properties such as being a weak acid due to the carboxylic acid functional group, which can donate protons in solution. The presence of the nitro group contributes to its electron-withdrawing characteristics, influencing its reactivity and potential applications in organic synthesis and medicinal chemistry. Additionally, the morpholine ring can enhance the compound's ability to interact with biological targets, making it of interest in pharmaceutical research. Its specific applications may vary, but it is often explored for its potential as a building block in drug development or as a reagent in chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₁H₁₂N₂O₅

InChI: InChI=1/C11H12N2O5/c14-11(15)9-7-8(13(16)17)1-2-10(9)12-3-5-18-6-4-12/h1-2,7H,3-6H2,(H,14,15)

SMILES: c1cc(c(cc1N(=O)=O)C(=O)O)N1CCOCC1

Synonyms:

• Benzoic acid, 2-(4-morpholinyl)-5-nitro-

2-Morpholino-5-nitrobenzoic acid

CAS: 4036-83-3

Formula: C₁₁H₁₂N₂O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 252.2234

Ref: IN-DA00CAI7

2-Morpholin-4-yl-5-nitrobenzoic acid

CAS: 4036-83-3

2-Morpholin-4-yl-5-nitrobenzoic acid

Purity: 95%

Molecular weight: 252.22g/mol

Ref: 54-OR8190

5-Nitro-2-(morpholin-4-yl)benzoic acid

CAS: 4036-83-3

Formula: C₁₁H₁₂N₂O₅

Purity: 98%

Molecular weight: 252.226

Ref: 10-F034185

5-Nitro-2-(morpholin-4-yl)benzoic acid

CAS: 4036-83-3

5-Nitro-2-(morpholin-4-yl)benzoic acid is a cytotoxic agent that induces apoptosis in cells. This compound binds to tubulin and inhibits its polymerization, which leads to the disruption of microtubules. 5NMBA has potent cytotoxicity against cancer cells, including human lung cancer cells. It has been shown to be a potent inhibitor of paclitaxel polymerization, and also can disrupt the polymerization of other drugs such as colchicine and vinblastine. 5NMBA expresses itself at high levels in human lung cancer tissues and is often found in multidrug resistant tumor cells.

Formula: C₁₁H₁₂N₂O₅

Purity: Min. 95%

Molecular weight: 252.22 g/mol

Ref: 3D-EAA03683