CAS 40360-44-9

3,5,6-Trichloropyridine-2-carboxylic acid

Description:

3,5,6-Trichloropyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyridine ring structure substituted with three chlorine atoms and a carboxylic acid group. The presence of chlorine atoms at the 3, 5, and 6 positions of the pyridine ring contributes to its unique chemical properties, including increased reactivity and potential for various chemical transformations. The carboxylic acid functional group enhances its acidity and solubility in polar solvents, making it useful in various chemical applications. This compound is often utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its ability to act as an intermediate in organic reactions. Additionally, the chlorinated pyridine derivatives are known for their biological activity, which may include herbicidal or fungicidal properties. Safety considerations should be taken into account when handling this compound, as chlorinated compounds can pose environmental and health risks. Overall, 3,5,6-Trichloropyridine-2-carboxylic acid is a versatile compound with significant implications in chemical research and industry.

Formula: C₆H₂Cl₃NO₂

InChI: InChI=1/C6H2Cl3NO2/c7-2-1-3(8)5(9)10-4(2)6(11)12/h1H,(H,11,12)

SMILES: c1c(c(C(=O)O)nc(c1Cl)Cl)Cl

Synonyms:

• 2-Pyridinecarboxylic Acid, 3,5,6-Trichloro-

3,5,6-Trichloropicolinic acid

CAS: 40360-44-9

Formula: C₆H₂Cl₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 226.4446

Ref: IN-DA00C7LE

3,5,6-Trichloropicolinic acid

CAS: 40360-44-9

3,5,6-Trichloropicolinic acid

Formula: C₆H₂Cl₃NO₂

Purity: 97%

Color and Shape: white solid

Molecular weight: 226.44g/mol

Ref: 54-OR902337

3,5,6-Trichloropicolinic acid

CAS: 40360-44-9

Formula: C₆H₂Cl₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 226.44

Ref: 10-F079746