CAS 403640-27-7
:Methiozolin
Description:
Methiozolin, identified by the CAS number 403640-27-7, is a chemical compound that belongs to the class of sulfonamide herbicides. It is primarily utilized in agricultural applications for its effectiveness in controlling a variety of weeds. Methiozolin functions by inhibiting specific biochemical pathways in plants, thereby disrupting their growth and development. The compound is characterized by its selective action, which allows it to target certain weed species while minimizing harm to desirable crops. Methiozolin is typically applied pre-emergence or post-emergence, depending on the target weeds and crop types. Its chemical structure features a sulfonamide group, which is crucial for its herbicidal activity. Additionally, Methiozolin is known for its relatively low toxicity to humans and non-target organisms, making it a preferred choice in integrated pest management strategies. As with any chemical substance, proper handling and application according to regulatory guidelines are essential to ensure safety and environmental protection.
Formula:C17H17F2NO2S
InChI:InChI=1S/C17H17F2NO2S/c1-11-6-7-23-16(11)15-8-17(2,22-20-15)10-21-9-12-13(18)4-3-5-14(12)19/h3-7H,8-10H2,1-2H3
InChI key:InChIKey=OPEJGICLTMWFNQ-UHFFFAOYSA-N
SMILES:CC1=C(C=2CC(COCC3=C(F)C=CC=C3F)(C)ON2)SC=C1
Synonyms:- 403640-27-7
- 5-[[(2,6-Difluorophenyl)methoxy]methyl]-4,5-dihydro-5-methyl-3-(3-methyl-2-thienyl)isoxazole
- Isoxazole, 5-[[(2,6-difluorophenyl)methoxy]methyl]-4,5-dihydro-5-methyl-3-(3-methyl-2-thienyl)-
- Methiozolin
- T5Sj C1B- Et5No Eutj C1 C1O1R Bf Ff
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methiozolin
CAS:Controlled Product<p>Applications Methiozolin is commonly used in herbicidal mixtures. it is a bluegrass selective herbicide.<br>References Auler, T., et al.: PCT Int. Appl., 51 (2020); Kim, J., et al.: J. Agric. Food. Chem., 67, 13534-13543 (2019)<br></p>Formula:C17H17F2NO2SColor and Shape:Off-White To Light BeigeMolecular weight:337.3842Methiozolin 100 µg/mL in Acetonitrile
CAS:Formula:C17H17F2NO2SColor and Shape:Single SolutionMolecular weight:337.3842Methiozolin
CAS:<p>Methiozolin is an herbicide, which is a synthetic compound with a specific mode of action. It targets the cell division process, specifically inhibiting the synthesis of very-long-chain fatty acids in plants. This mode of action makes Methiozolin effective against problematic weed species such as annual bluegrass (Poa annua), which is known for its pervasive growth in turfgrass systems.</p>Formula:C17H17F2NO2SPurity:Min. 95%Molecular weight:337.4 g/molRef: 3D-DRA64027
Discontinued product


