CymitQuimica logo

CAS 403655-90-3

:

1-Cyclopentyl-1,3-dihydro-4-methyl-2H-imidazol-2-one

Description:
1-Cyclopentyl-1,3-dihydro-4-methyl-2H-imidazol-2-one, identified by its CAS number 403655-90-3, is a heterocyclic organic compound featuring an imidazole ring. This compound is characterized by its five-membered ring structure, which includes nitrogen atoms that contribute to its basicity and potential reactivity. The presence of a cyclopentyl group enhances its hydrophobic characteristics, while the methyl group at the 4-position of the imidazole ring can influence its steric and electronic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the imidazole moiety is known for its role in various biochemical processes, including enzyme catalysis and coordination with metal ions. Overall, 1-Cyclopentyl-1,3-dihydro-4-methyl-2H-imidazol-2-one represents a unique structure that may have applications in pharmaceuticals or agrochemicals.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-7-6-11(9(12)10-7)8-4-2-3-5-8/h6,8H,2-5H2,1H3,(H,10,12)
InChI key:InChIKey=FFFAGLULJBZGKT-UHFFFAOYSA-N
SMILES:O=C1N(C=C(C)N1)C2CCCC2
Synonyms:
  • 1-Cyclopentyl-4-methyl-2,3-dihydro-1H-imidazol-2-one
  • 1-Cyclopentyl-4-methyl-1H-imidazol-2(3H)-one
  • 1-Cyclopentyl-1,3-dihydro-4-methyl-2H-imidazol-2-one
  • 2H-Imidazol-2-one, 1-cyclopentyl-1,3-dihydro-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.