CAS 4037-01-8
:adrenocorticotropic hormone fragment*4-10 human
Description:
Adrenocorticotropic hormone fragment 4-10 (ACTH 4-10) is a peptide derived from the larger adrenocorticotropic hormone (ACTH), which plays a crucial role in the regulation of cortisol production from the adrenal glands. The fragment consists of a specific sequence of amino acids that corresponds to positions 4 to 10 of the full ACTH molecule. This peptide is known for its biological activity, particularly in influencing adrenal function and modulating stress responses. It has been studied for its potential therapeutic applications, including its effects on inflammation and immune response. The CAS number 4037-01-8 uniquely identifies this specific peptide in chemical databases, facilitating research and regulatory processes. In terms of physical properties, ACTH 4-10 is typically a white to off-white powder, soluble in water, and exhibits stability under proper storage conditions. Its biological activity is often assessed through various in vitro and in vivo studies, contributing to our understanding of its role in endocrinology and potential clinical applications.
Formula:C19H20ClF3N2O3
InChI:InChI=1/C19H20ClF3N2O3/c1-3-28-16-7-4-12(10-17(16)27-2)8-9-24-18(26)25-15-11-13(19(21,22)23)5-6-14(15)20/h4-7,10-11H,3,8-9H2,1-2H3,(H2,24,25,26)
SMILES:CCOc1ccc(CCN=C(Nc2cc(ccc2Cl)C(F)(F)F)O)cc1OC
Synonyms:- Acth (4-10)
- H-Met-Glu-His-Phe-Arg-Trp-Gly-OH
- L-methionyl-L-alpha-glutamyl-L-histidyl-L-phenylalanyl-N~5~-(diaminomethylidene)-L-ornithyl-L-tryptophylglycine
- 1-[2-Chloro-5-(Trifluoromethyl)Phenyl]-3-[2-(4-Ethoxy-3-Methoxyphenyl)Ethyl]Urea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
ACTH (4-10)
CAS:Application of ACTH 4-10 reduced body weight in humans by enhancing energy expenditure and suppressing appetite, but it did not act in overweight persons. Long-term administration of the peptide also improved memory functions.Formula:C44H59N13O10SPurity:98.3%Color and Shape:WhiteMolecular weight:962.1Adrenocorticotropic Hormone (ACTH) (4-10), human
CAS:Adrenocorticotropic Hormone (ACTH) (4-10) is an agonist of potent melanocortin(MC4R) receptor .Formula:C44H59N13O10SPurity:98%Color and Shape:SolidMolecular weight:962.09ACTH (4-10) trifluoroacetate salt
CAS:ACTH (4-10) trifluoroacetate salt is a cholinergic agent that belongs to the class of neurotransmitters. It is synthesized from the naturally occurring hormone ACTH, which is released by the anterior pituitary gland in response to a variety of stimuli. This compound has been shown to have physiological effects on various organs, including adipose tissue and locomotor activity. It also shows neuroprotective effects in animal models and has neurotrophic properties. The therapeutic potential of this compound for brain functions is currently being explored.Formula:C44H59N13O10SPurity:Min. 95%Molecular weight:962.09 g/mol


