CAS 40372-00-7: 1-beta-D-Ribofuranosyl-1,2,4-triazole-3-carboxamidine hydrochloride
Description:1-beta-D-Ribofuranosyl-1,2,4-triazole-3-carboxamidine hydrochloride is a chemical compound characterized by its unique structure, which includes a ribofuranosyl moiety linked to a triazole ring. This compound is notable for its potential biological activity, particularly in the field of antiviral research, as it may exhibit properties that inhibit viral replication. The presence of the carboxamidine functional group contributes to its reactivity and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmacological applications. The compound's molecular formula reflects its composition, which includes carbon, hydrogen, nitrogen, and oxygen atoms. Its CAS number, 40372-00-7, serves as a unique identifier for regulatory and research purposes. Overall, this substance is of interest in medicinal chemistry due to its potential therapeutic applications and the ongoing exploration of its mechanisms of action against various pathogens.
Formula:C8H14ClN5O4
InChI:InChI=1/C8H13N5O4.ClH/c9-6(10)7-11-2-13(12-7)8-5(16)4(15)3(1-14)17-8;/h2-5,8,14-16H,1H2,(H3,9,10);1H/t3-,4-,5-,8?;/m1./s1
- Synonyms:
- Viramidine hydrochloride
- Ribamidine hydrochloride
- ICN-3142(hydrochloride)
- Avs-000206
- Avs-206
- 1-beta-D-Ribofuranosyl-1H-1,2,4-triazole-3-carboximidamide hydrochloride
- 1-(D-ribofuranosyl)-1H-1,2,4-triazole-3-carboximidamide hydrochloride (1:1)
