CAS 40372-03-0: 1-(2,3,5-Tri-O-acetyl-β-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide
Description:1-(2,3,5-Tri-O-acetyl-β-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide is a chemical compound characterized by its complex structure, which includes a ribofuranosyl sugar moiety and a triazole ring. The presence of three acetyl groups on the ribofuranosyl unit enhances its solubility and stability, making it suitable for various biochemical applications. The triazole ring contributes to the compound's potential as a bioactive agent, often associated with antimicrobial and antifungal properties. The carboxamide functional group is known for its ability to participate in hydrogen bonding, which can influence the compound's interactions with biological targets. This compound is typically synthesized through multi-step organic reactions, and its properties can be influenced by factors such as pH and solvent conditions. Overall, its unique structural features make it a subject of interest in medicinal chemistry and pharmaceutical research, particularly in the development of nucleoside analogs and other therapeutic agents.
Formula:C14H18N4O8
InChI:InChI=1S/C14H18N4O8/c1-6(19)23-4-9-10(24-7(2)20)11(25-8(3)21)14(26-9)18-5-16-13(17-18)12(15)22/h5,9-11,14H,4H2,1-3H3,(H2,15,22)/t9-,10-,11-,14-/m1/s1
InChI key:InChIKey=XVXXBJKZJDPHAU-ZHSDAYTOSA-N
SMILES:O=C(OCC1OC(N2N=C(N=C2)C(=O)N)C(OC(=O)C)C1OC(=O)C)C
- Synonyms:
- 1-(2,3,5-Tri-O-acetyl-β-<span class="text-smallcaps">D</span>-ribofuranosyl)-1,2,4-triazole-3-carboxamide
- 1-(2,3,5-Tri-O-acetyl-β-<span class="text-smallcaps">D</span>-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide
- 1-[2,3,5-Tri-O-acetyl-.beta.-d-ribofuranosyl]-1,2,4-triazole-3-carboxamide
- 1-[2,3,5-Tri-o-acetyl-β-d-ribofuranosyl]-1,2,4-triazole-3-carboxamide
- 1H-1,2,4-Triazole-3-carboxamide, 1-(2,3,5-tri-O-acetyl-β-<span class="text-smallcaps">D</span>-ribofuranosyl)-
- Tri-O-acetylribavirin
- 1H-1,2,4-Triazole-3-carboxamide, 1-(2,3,5-tri-O-acetyl-β-D-ribofuranosyl)-
- 1-(2,3,5-Tri-O-acetyl-β-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Ribavirin 2,3,5-Tri-O-acetyl REF: TR-R414515CAS: 40372-03-0 | - - - | 292.00 €~1,959.00 € | Tue 06 May 25 |

Ribavirin 2,3,5-Tri-O-acetyl
Controlled ProductRef: TR-R414515
50mg | 292.00 € | ||
500mg | 1,959.00 € |